CAS 2173361-80-1 appears in our catalog under these names: Tau tracer 2, Tau tracer 2 95%, 2-(2-Fluoropyridin-4-yl)-9H-pyrrolo[2,3-b:4,5-c']dipyridine, 99.92%, 99.92%, Tau tracer 2, 99.92%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 50 mg, 10mM/1mL, 10 mg.
11-(2-fluoro-4-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (CAS 2173361-80-1) is a chemical compound with the molecular formula C15H9FN4 and a molecular weight of 264.26 g/mol. IUPAC name: 11-(2-fluoro-4-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene. InChIKey: JUPWIBZGGFVBCU-UHFFFAOYSA-N.
| Molecular formula | C15H9FN4 |
|---|---|
| Molecular weight | 264.26 g/mol |
| IUPAC name | 11-(2-fluoro-4-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| InChIKey | JUPWIBZGGFVBCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C3=C(N2)C=CN=C3)C4=CC(=NC=C4)F |
Computed by PubChem (NCBI)