Products 2173362-84-8
CAS 2173362-84-8 is the registry number for 2,9-Bis(2,4,6-triethylphenyl)-1,10-phenanthroline, 98%. Offered by: Chemat. Available pack sizes: 50mg.
2,9-bis(2,4,6-triethylphenyl)-1,10-phenanthroline (CAS 2173362-84-8) is a chemical compound with the molecular formula C36H40N2 and a molecular weight of 500.7 g/mol. IUPAC name: 2,9-bis(2,4,6-triethylphenyl)-1,10-phenanthroline. InChIKey: WNKPMONQLJITLS-UHFFFAOYSA-N.
| Molecular formula | C36H40N2 |
|---|---|
| Molecular weight | 500.7 g/mol |
| IUPAC name | 2,9-bis(2,4,6-triethylphenyl)-1,10-phenanthroline |
| InChIKey | WNKPMONQLJITLS-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C(=C1)CC)C2=NC3=C(C=CC4=C3N=C(C=C4)C5=C(C=C(C=C5CC)CC)CC)C=C2)CC |
Computed by PubChem (NCBI)