Products 2173554-85-1
CAS 2173554-85-1 appears in our catalog under these names: 2-(8-Chlorodibenzo[b,d]furan-1-yl)-4,6-diphenyl-1,3,5-triazine, 98%, 98%, 2-(8-Chlorodibenzo[b,d]furan-1-yl)-4,6-diphenyl-1,3,5-triazine, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
2-(8-chlorodibenzofuran-1-yl)-4,6-diphenyl-1,3,5-triazine (CAS 2173554-85-1) is a chemical compound with the molecular formula C27H16ClN3O and a molecular weight of 433.9 g/mol. IUPAC name: 2-(8-chlorodibenzofuran-1-yl)-4,6-diphenyl-1,3,5-triazine. InChIKey: KBYZBOKBZLTSPI-UHFFFAOYSA-N.
| Molecular formula | C27H16ClN3O |
|---|---|
| Molecular weight | 433.9 g/mol |
| IUPAC name | 2-(8-chlorodibenzofuran-1-yl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | KBYZBOKBZLTSPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=C4C(=CC=C3)OC5=C4C=C(C=C5)Cl)C6=CC=CC=C6 |
Computed by PubChem (NCBI)