Products 2173992-33-9

CAS 2173992-33-9 is the registry number for 1-(2,7-Diazaspiro[3.5]nonan-7-yl)ethan-1-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.

Structural formula: {0} (CAS {1})

1-(2,7-diazaspiro[3.5]nonan-7-yl)ethanone;hydrochloride (CAS 2173992-33-9) is a chemical compound with the molecular formula C9H17ClN2O and a molecular weight of 204.70 g/mol. IUPAC name: 1-(2,7-diazaspiro[3.5]nonan-7-yl)ethanone;hydrochloride. InChIKey: YACLOXOOUCHMRO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17ClN2O
Molecular weight204.70 g/mol
IUPAC name1-(2,7-diazaspiro[3.5]nonan-7-yl)ethanone;hydrochloride
InChIKeyYACLOXOOUCHMRO-UHFFFAOYSA-N
SMILESCC(=O)N1CCC2(CC1)CNC2.Cl

Computed by PubChem (NCBI)