CAS 2173992-44-2 appears in our catalog under these names: Oxalic acid bis(tert-butyl 4-([(tert-butoxy)carbonyl]amino)piperidine-4-carboxylate), 95%, tert-Butyl 4-((tert-butoxycarbonyl)amino)piperidine-4-carboxylate hemioxalate, 97%, tert-butyl 4-(tert-butoxycarbonylamino)piperidine-4-carboxylate,hemi(oxalic acid), 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 250mg, 500mg.
Bis(tert-butyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylate);oxalic acid (CAS 2173992-44-2) is a chemical compound with the molecular formula C32H58N4O12 and a molecular weight of 690.8 g/mol. IUPAC name: bis(tert-butyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylate);oxalic acid. InChIKey: ASPNUUZTOLWXAO-UHFFFAOYSA-N.
| Molecular formula | C32H58N4O12 |
|---|---|
| Molecular weight | 690.8 g/mol |
| IUPAC name | bis(tert-butyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylate);oxalic acid |
| InChIKey | ASPNUUZTOLWXAO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1(CCNCC1)NC(=O)OC(C)(C)C.CC(C)(C)OC(=O)C1(CCNCC1)NC(=O)OC(C)(C)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)