Products 2173992-59-9
CAS 2173992-59-9 is the registry number for rac-(1R,6S)-2-Oxabicyclo(4.2.0)octan-7-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S,6R)-2-oxabicyclo[4.2.0]octan-7-amine;hydrochloride (CAS 2173992-59-9) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (1S,6R)-2-oxabicyclo[4.2.0]octan-7-amine;hydrochloride. InChIKey: BIXXSQBQDHGGSW-NAZYBQMSSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (1S,6R)-2-oxabicyclo[4.2.0]octan-7-amine;hydrochloride |
| InChIKey | BIXXSQBQDHGGSW-NAZYBQMSSA-N |
| SMILES | C1C[C@H]2[C@H](CC2N)OC1.Cl |
Computed by PubChem (NCBI)