Products 2173996-25-1

CAS 2173996-25-1 is the registry number for Rel-1-(tert-butyl) 3-ethyl (3R,4S)-4-fluoropiperidine-1,3-dicarboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg, 5g.

1-O-tert-butyl 3-O-ethyl (3S,4R)-4-fluoropiperidine-1,3-dicarboxylate (CAS 2173996-25-1) is a chemical compound with the molecular formula C13H22FNO4 and a molecular weight of 275.32 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S,4R)-4-fluoropiperidine-1,3-dicarboxylate. InChIKey: LVHRATXZLPYMHL-NXEZZACHSA-N.

Identity
Molecular formulaC13H22FNO4
Molecular weight275.32 g/mol
IUPAC name1-O-tert-butyl 3-O-ethyl (3S,4R)-4-fluoropiperidine-1,3-dicarboxylate
InChIKeyLVHRATXZLPYMHL-NXEZZACHSA-N
SMILESCCOC(=O)[C@@H]1CN(CC[C@H]1F)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)