CAS 2173996-30-8 is the registry number for (4-(5,6,7,8-Tetrahydronaphthalen-2-yl)thiophen-2-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-2-yl]methanamine;hydrochloride (CAS 2173996-30-8) is a chemical compound with the molecular formula C15H18ClNS and a molecular weight of 279.8 g/mol. IUPAC name: [4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-2-yl]methanamine;hydrochloride. InChIKey: LWWOQUDKPXPBTC-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNS |
|---|---|
| Molecular weight | 279.8 g/mol |
| IUPAC name | [4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-2-yl]methanamine;hydrochloride |
| InChIKey | LWWOQUDKPXPBTC-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)C3=CSC(=C3)CN.Cl |
Computed by PubChem (NCBI)