CAS 2173996-71-7 is the registry number for 1,1,1-Trifluoro-N-methylpropan-2-amine 2,2,2-trifluoroacetate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,2,2-trifluoroacetic acid;1,1,1-trifluoro-N-methylpropan-2-amine (CAS 2173996-71-7) is a chemical compound with the molecular formula C6H9F6NO2 and a molecular weight of 241.13 g/mol. IUPAC name: 2,2,2-trifluoroacetic acid;1,1,1-trifluoro-N-methylpropan-2-amine. InChIKey: RVHZQJFZRZJJNL-UHFFFAOYSA-N.
| Molecular formula | C6H9F6NO2 |
|---|---|
| Molecular weight | 241.13 g/mol |
| IUPAC name | 2,2,2-trifluoroacetic acid;1,1,1-trifluoro-N-methylpropan-2-amine |
| InChIKey | RVHZQJFZRZJJNL-UHFFFAOYSA-N |
| SMILES | CC(C(F)(F)F)NC.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)