CAS 2173998-97-3 is the registry number for rac-(1R,2R)-2-(4-Methylphenyl)cyclopropane-1-carbohydrazide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Trans-(1R,2R)-2-(4-methylphenyl)cyclopropane-1-carbohydrazide (CAS 2173998-97-3) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: trans-(1R,2R)-2-(4-methylphenyl)cyclopropane-1-carbohydrazide. InChIKey: FIPFFUWDRAOWFF-VHSXEESVSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-methylphenyl)cyclopropane-1-carbohydrazide |
| InChIKey | FIPFFUWDRAOWFF-VHSXEESVSA-N |
| SMILES | CC1=CC=C(C=C1)[C@@H]2C[C@H]2C(=O)NN |
Computed by PubChem (NCBI)