CAS 2173999-43-2 is the registry number for 4-(5-Bromothiophen-2-yl)-1,3-thiazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4-(5-bromothiophen-2-yl)-1,3-thiazol-2-amine;hydrochloride (CAS 2173999-43-2) is a chemical compound with the molecular formula C7H6BrClN2S2 and a molecular weight of 297.6 g/mol. IUPAC name: 4-(5-bromothiophen-2-yl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: IAHHOIPLUORWRU-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClN2S2 |
|---|---|
| Molecular weight | 297.6 g/mol |
| IUPAC name | 4-(5-bromothiophen-2-yl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | IAHHOIPLUORWRU-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)C2=CSC(=N2)N.Cl |
Computed by PubChem (NCBI)