Products 2173999-43-2

CAS 2173999-43-2 is the registry number for 4-(5-Bromothiophen-2-yl)-1,3-thiazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-(5-bromothiophen-2-yl)-1,3-thiazol-2-amine;hydrochloride (CAS 2173999-43-2) is a chemical compound with the molecular formula C7H6BrClN2S2 and a molecular weight of 297.6 g/mol. IUPAC name: 4-(5-bromothiophen-2-yl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: IAHHOIPLUORWRU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BrClN2S2
Molecular weight297.6 g/mol
IUPAC name4-(5-bromothiophen-2-yl)-1,3-thiazol-2-amine;hydrochloride
InChIKeyIAHHOIPLUORWRU-UHFFFAOYSA-N
SMILESC1=C(SC(=C1)Br)C2=CSC(=N2)N.Cl

Computed by PubChem (NCBI)