CAS 2173999-91-0 is the registry number for rac-(1R,4S,6R)-3,3-Dimethyl-2-oxabicyclo(2.2.2)octan-6-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,4S,6R)-3,3-dimethyl-2-oxabicyclo[2.2.2]octan-6-ol (CAS 2173999-91-0) is a chemical compound with the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. IUPAC name: (1R,4S,6R)-3,3-dimethyl-2-oxabicyclo[2.2.2]octan-6-ol. InChIKey: APVNWJMMPRPJSG-XLPZGREQSA-N.
| Molecular formula | C9H16O2 |
|---|---|
| Molecular weight | 156.22 g/mol |
| IUPAC name | (1R,4S,6R)-3,3-dimethyl-2-oxabicyclo[2.2.2]octan-6-ol |
| InChIKey | APVNWJMMPRPJSG-XLPZGREQSA-N |
| SMILES | CC1([C@H]2CC[C@@H](O1)[C@@H](C2)O)C |
Computed by PubChem (NCBI)