Products 2174000-30-5

CAS 2174000-30-5 is the registry number for 2-(1-(2-Fluoroethyl)piperidin-4-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-[1-(2-fluoroethyl)piperidin-4-yl]acetic acid;hydrochloride (CAS 2174000-30-5) is a chemical compound with the molecular formula C9H17ClFNO2 and a molecular weight of 225.69 g/mol. IUPAC name: 2-[1-(2-fluoroethyl)piperidin-4-yl]acetic acid;hydrochloride. InChIKey: VIABSHLJQYMVHT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17ClFNO2
Molecular weight225.69 g/mol
IUPAC name2-[1-(2-fluoroethyl)piperidin-4-yl]acetic acid;hydrochloride
InChIKeyVIABSHLJQYMVHT-UHFFFAOYSA-N
SMILESC1CN(CCC1CC(=O)O)CCF.Cl

Computed by PubChem (NCBI)