CAS 2174001-66-0 is the registry number for Thieno(3,2-b)pyridin-6-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Thieno[3,2-b]pyridin-6-amine;dihydrochloride (CAS 2174001-66-0) is a chemical compound with the molecular formula C7H8Cl2N2S and a molecular weight of 223.12 g/mol. IUPAC name: thieno[3,2-b]pyridin-6-amine;dihydrochloride. InChIKey: AYPRMGIKPDFAKB-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N2S |
|---|---|
| Molecular weight | 223.12 g/mol |
| IUPAC name | thieno[3,2-b]pyridin-6-amine;dihydrochloride |
| InChIKey | AYPRMGIKPDFAKB-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1N=CC(=C2)N.Cl.Cl |
Computed by PubChem (NCBI)