Products 2174002-00-5
CAS 2174002-00-5 is the registry number for rac-(1R,3R)-3-Ethenylcyclohexan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Trans-(1R,3R)-3-ethenylcyclohexan-1-amine;hydrochloride (CAS 2174002-00-5) is a chemical compound with the molecular formula C8H16ClN and a molecular weight of 161.67 g/mol. IUPAC name: trans-(1R,3R)-3-ethenylcyclohexan-1-amine;hydrochloride. InChIKey: LUIFCDDPURWBGH-SCLLHFNJSA-N.
| Molecular formula | C8H16ClN |
|---|---|
| Molecular weight | 161.67 g/mol |
| IUPAC name | trans-(1R,3R)-3-ethenylcyclohexan-1-amine;hydrochloride |
| InChIKey | LUIFCDDPURWBGH-SCLLHFNJSA-N |
| SMILES | C=C[C@@H]1CCC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)