CAS 2174002-41-4 is the registry number for rac-(1R,3S)-3-Ethoxy-N-methylspiro(3.4)octan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S,3R)-3-ethoxy-N-methylspiro[3.4]octan-1-amine;hydrochloride (CAS 2174002-41-4) is a chemical compound with the molecular formula C11H22ClNO and a molecular weight of 219.75 g/mol. IUPAC name: (1S,3R)-3-ethoxy-N-methylspiro[3.4]octan-1-amine;hydrochloride. InChIKey: XDODVRHVVIBDSK-BAUSSPIASA-N.
| Molecular formula | C11H22ClNO |
|---|---|
| Molecular weight | 219.75 g/mol |
| IUPAC name | (1S,3R)-3-ethoxy-N-methylspiro[3.4]octan-1-amine;hydrochloride |
| InChIKey | XDODVRHVVIBDSK-BAUSSPIASA-N |
| SMILES | CCO[C@@H]1C[C@@H](C12CCCC2)NC.Cl |
Computed by PubChem (NCBI)