Products 21744-91-2

CAS 21744-91-2 is the registry number for Ethyl 1-formylcyclopentane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 1-formylcyclopentane-1-carboxylate (CAS 21744-91-2) is a chemical compound with the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. IUPAC name: ethyl 1-formylcyclopentane-1-carboxylate. InChIKey: XAQBQBBBZHHWNA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14O3
Molecular weight170.21 g/mol
IUPAC nameethyl 1-formylcyclopentane-1-carboxylate
InChIKeyXAQBQBBBZHHWNA-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCCC1)C=O

Computed by PubChem (NCBI)