CAS 217487-19-9 is the registry number for Menadione Sodium Bisulfite Hydrate, >95% (HPLC). Offered by: TRC. Available pack sizes: 10g, 50g, 5g.
Sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate (CAS 217487-19-9) is a chemical compound with the molecular formula C11H11NaO6S and a molecular weight of 294.26 g/mol. IUPAC name: sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate. InChIKey: QXTQSPTXVLMLHQ-UHFFFAOYSA-M.
| Molecular formula | C11H11NaO6S |
|---|---|
| Molecular weight | 294.26 g/mol |
| IUPAC name | sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate |
| InChIKey | QXTQSPTXVLMLHQ-UHFFFAOYSA-M |
| SMILES | CC1(CC(=O)C2=CC=CC=C2C1=O)S(=O)(=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)