CAS 217636-47-0 appears in our catalog under these names: Fenofibric acid Impurity E,Fenofibrate EP Impurity C, Fenofibrate EP Impurity C, Fenofibrate Impurity 3(Fenofibrate EP Impurity C), 3-(4-(4-Chlorobenzoyl)phenoxy)-2-butanone (Fenofibrate Impurity), >95% (HPLC), 3-(4-(4-Chlorobenzoyl)phenoxy)-2-butanone(Fenofibrate Impurity), >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1000mg.
3-[4-(4-chlorobenzoyl)phenoxy]butan-2-one (CAS 217636-47-0) is a chemical compound with the molecular formula C17H15ClO3 and a molecular weight of 302.7 g/mol. IUPAC name: 3-[4-(4-chlorobenzoyl)phenoxy]butan-2-one. InChIKey: UGIBXSPOZIFSQB-UHFFFAOYSA-N.
| Molecular formula | C17H15ClO3 |
|---|---|
| Molecular weight | 302.7 g/mol |
| IUPAC name | 3-[4-(4-chlorobenzoyl)phenoxy]butan-2-one |
| InChIKey | UGIBXSPOZIFSQB-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C)OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)