CAS 21768-47-8 is the registry number for (3S,4R)-3-Amino-4-hydroxyoxolan-2-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3S,4R)-3-amino-4-hydroxyoxolan-2-one;hydrochloride (CAS 21768-47-8) is a chemical compound with the molecular formula C4H8ClNO3 and a molecular weight of 153.56 g/mol. IUPAC name: (3S,4R)-3-amino-4-hydroxyoxolan-2-one;hydrochloride. InChIKey: FDYPTEKFELZRBJ-GVOALSEPSA-N.
| Molecular formula | C4H8ClNO3 |
|---|---|
| Molecular weight | 153.56 g/mol |
| IUPAC name | (3S,4R)-3-amino-4-hydroxyoxolan-2-one;hydrochloride |
| InChIKey | FDYPTEKFELZRBJ-GVOALSEPSA-N |
| SMILES | C1[C@@H]([C@@H](C(=O)O1)N)O.Cl |
Computed by PubChem (NCBI)