CAS 2177257-85-9 appears in our catalog under these names: (R)-2-(1-Amino-2-hydroxyethyl)-5-fluorophenol hydrochloride, 95%, (R)-2-(1-amino-2-hydroxyethyl)-5-fluorophenol hydrochloride, 95%, 95%, (R)-2-(1-amino-2-hydroxyethyl)-5-fluorophenol hydrochloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-[(1R)-1-amino-2-hydroxyethyl]-5-fluorophenol;hydrochloride (CAS 2177257-85-9) is a chemical compound with the molecular formula C8H11ClFNO2 and a molecular weight of 207.63 g/mol. IUPAC name: 2-[(1R)-1-amino-2-hydroxyethyl]-5-fluorophenol;hydrochloride. InChIKey: DPQZVOINFPLYHQ-FJXQXJEOSA-N.
| Molecular formula | C8H11ClFNO2 |
|---|---|
| Molecular weight | 207.63 g/mol |
| IUPAC name | 2-[(1R)-1-amino-2-hydroxyethyl]-5-fluorophenol;hydrochloride |
| InChIKey | DPQZVOINFPLYHQ-FJXQXJEOSA-N |
| SMILES | C1=CC(=C(C=C1F)O)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)