Products 2177258-50-1

CAS 2177258-50-1 is the registry number for 8-Benzyl 2-tert-butyl 7-methyl 5-oxa-2,8-diazaspiro[3.5]nonane-2,7,8-tricarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

8-O-benzyl 2-O-tert-butyl 7-O-methyl 5-oxa-2,8-diazaspiro[3.5]nonane-2,7,8-tricarboxylate (CAS 2177258-50-1) is a chemical compound with the molecular formula C21H28N2O7 and a molecular weight of 420.5 g/mol. IUPAC name: 8-O-benzyl 2-O-tert-butyl 7-O-methyl 5-oxa-2,8-diazaspiro[3.5]nonane-2,7,8-tricarboxylate. InChIKey: LEFRJEXHDSKIOQ-UHFFFAOYSA-N.

Identity
Molecular formulaC21H28N2O7
Molecular weight420.5 g/mol
IUPAC name8-O-benzyl 2-O-tert-butyl 7-O-methyl 5-oxa-2,8-diazaspiro[3.5]nonane-2,7,8-tricarboxylate
InChIKeyLEFRJEXHDSKIOQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC2(C1)CN(C(CO2)C(=O)OC)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)