CAS 2177263-94-2 is the registry number for Di-tert-butyl 4-bromopyrazolidine-1,2-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ditert-butyl 4-bromopyrazolidine-1,2-dicarboxylate (CAS 2177263-94-2) is a chemical compound with the molecular formula C13H23BrN2O4 and a molecular weight of 351.24 g/mol. IUPAC name: ditert-butyl 4-bromopyrazolidine-1,2-dicarboxylate. InChIKey: GGVJRPVUHDIOEH-UHFFFAOYSA-N.
| Molecular formula | C13H23BrN2O4 |
|---|---|
| Molecular weight | 351.24 g/mol |
| IUPAC name | ditert-butyl 4-bromopyrazolidine-1,2-dicarboxylate |
| InChIKey | GGVJRPVUHDIOEH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CN1C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)