Products 2177264-67-2

CAS 2177264-67-2 is the registry number for 3-Aminomethyl-2-oxa-8-aza-spiro[4.5]decane-8-carboxylic acid tert-butyl ester oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-(aminomethyl)-2-oxa-8-azaspiro[4.5]decane-8-carboxylate;oxalic acid (CAS 2177264-67-2) is a chemical compound with the molecular formula C16H28N2O7 and a molecular weight of 360.40 g/mol. IUPAC name: tert-butyl 3-(aminomethyl)-2-oxa-8-azaspiro[4.5]decane-8-carboxylate;oxalic acid. InChIKey: JYAZFBGJBKOZHB-UHFFFAOYSA-N.

Identity
Molecular formulaC16H28N2O7
Molecular weight360.40 g/mol
IUPAC nametert-butyl 3-(aminomethyl)-2-oxa-8-azaspiro[4.5]decane-8-carboxylate;oxalic acid
InChIKeyJYAZFBGJBKOZHB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CC1)CC(OC2)CN.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)