CAS 2177264-67-2 is the registry number for 3-Aminomethyl-2-oxa-8-aza-spiro[4.5]decane-8-carboxylic acid tert-butyl ester oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Tert-butyl 3-(aminomethyl)-2-oxa-8-azaspiro[4.5]decane-8-carboxylate;oxalic acid (CAS 2177264-67-2) is a chemical compound with the molecular formula C16H28N2O7 and a molecular weight of 360.40 g/mol. IUPAC name: tert-butyl 3-(aminomethyl)-2-oxa-8-azaspiro[4.5]decane-8-carboxylate;oxalic acid. InChIKey: JYAZFBGJBKOZHB-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O7 |
|---|---|
| Molecular weight | 360.40 g/mol |
| IUPAC name | tert-butyl 3-(aminomethyl)-2-oxa-8-azaspiro[4.5]decane-8-carboxylate;oxalic acid |
| InChIKey | JYAZFBGJBKOZHB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(OC2)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)