Products 2177267-62-6
CAS 2177267-62-6 is the registry number for Trans-tert-butyl hexahydro-2h-pyrido[4,3-b][1,4]oxazine-4(3h)-carboxylate oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl (4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine-4-carboxylate;oxalic acid (CAS 2177267-62-6) is a chemical compound with the molecular formula C14H24N2O7 and a molecular weight of 332.35 g/mol. IUPAC name: tert-butyl (4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine-4-carboxylate;oxalic acid. InChIKey: DUUPWJLJMRKGSA-BAUSSPIASA-N.
| Molecular formula | C14H24N2O7 |
|---|---|
| Molecular weight | 332.35 g/mol |
| IUPAC name | tert-butyl (4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine-4-carboxylate;oxalic acid |
| InChIKey | DUUPWJLJMRKGSA-BAUSSPIASA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@H]2[C@@H]1CNCC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)