CAS 2177283-35-9 appears in our catalog under these names: Efavirenz Impurity 19, 2-Cyclobutenyl-3-trifluoromethyl-5-chloro-1H-indole-1-carboxylic Acid Ethyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
Ethyl 5-chloro-2-(cyclobuten-1-yl)-3-(trifluoromethyl)indole-1-carboxylate (CAS 2177283-35-9) is a chemical compound with the molecular formula C16H13ClF3NO2 and a molecular weight of 343.73 g/mol. IUPAC name: ethyl 5-chloro-2-(cyclobuten-1-yl)-3-(trifluoromethyl)indole-1-carboxylate. InChIKey: VSADVAHNRBTTNR-UHFFFAOYSA-N.
| Molecular formula | C16H13ClF3NO2 |
|---|---|
| Molecular weight | 343.73 g/mol |
| IUPAC name | ethyl 5-chloro-2-(cyclobuten-1-yl)-3-(trifluoromethyl)indole-1-carboxylate |
| InChIKey | VSADVAHNRBTTNR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1C2=C(C=C(C=C2)Cl)C(=C1C3=CCC3)C(F)(F)F |
Computed by PubChem (NCBI)