CAS 217798-39-5 appears in our catalog under these names: Ethaselen, Lorediplon, 95%, Ethaselen, 98%, Ethaselen/ 97.58% (existing batch purity), Lorediplon. Offered by: GLPBio, Combi-blocks, AmBeed, TargetMol, Biosynth. Available pack sizes: 5mg, 100mg, 1mg, 10mg, 25mg, 50mg, 10mM/1mL, 10 mg.
2-[2-(3-oxo-1,2-benzoselenazol-2-yl)ethyl]-1,2-benzoselenazol-3-one (CAS 217798-39-5) is a chemical compound with the molecular formula C16H12N2O2Se2 and a molecular weight of 422.2 g/mol. IUPAC name: 2-[2-(3-oxo-1,2-benzoselenazol-2-yl)ethyl]-1,2-benzoselenazol-3-one. InChIKey: SFFSGPCYJCMDJM-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2Se2 |
|---|---|
| Molecular weight | 422.2 g/mol |
| IUPAC name | 2-[2-(3-oxo-1,2-benzoselenazol-2-yl)ethyl]-1,2-benzoselenazol-3-one |
| InChIKey | SFFSGPCYJCMDJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N([Se]2)CCN3C(=O)C4=CC=CC=C4[Se]3 |
Computed by PubChem (NCBI)