CAS 217798-45-3 is the registry number for NSD2-PWWP1-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-aminophenyl)-1,2-benzoselenazol-3-one (CAS 217798-45-3) is a chemical compound with the molecular formula C13H10N2OSe and a molecular weight of 289.20 g/mol. IUPAC name: 2-(4-aminophenyl)-1,2-benzoselenazol-3-one. InChIKey: OEBCJOYKKPAJTD-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OSe |
|---|---|
| Molecular weight | 289.20 g/mol |
| IUPAC name | 2-(4-aminophenyl)-1,2-benzoselenazol-3-one |
| InChIKey | OEBCJOYKKPAJTD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N([Se]2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)