CAS 2178052-55-4 appears in our catalog under these names: 5-(2,4,6-Trifluorophenyl)isoxazole-3-carboxylic acid, 97%, 5-(2,4,6-Trifluorophenyl)-1,2-oxazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(2,4,6-trifluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 2178052-55-4) is a chemical compound with the molecular formula C10H4F3NO3 and a molecular weight of 243.14 g/mol. IUPAC name: 5-(2,4,6-trifluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: MVRMOOSVRYQSSD-UHFFFAOYSA-N.
| Molecular formula | C10H4F3NO3 |
|---|---|
| Molecular weight | 243.14 g/mol |
| IUPAC name | 5-(2,4,6-trifluorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | MVRMOOSVRYQSSD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C2=CC(=NO2)C(=O)O)F)F |
Computed by PubChem (NCBI)