Products 2178156-33-5
CAS 2178156-33-5 appears in our catalog under these names: (S)-2-Amino-4-(butylamino)-N-(1-phenylethyl)quinazoline-5-carboxamide, 98.95%, 98.95%, TLR7 agonist 1, 98.19%. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 10mM/1mL, 5 mg, 10 mg, 25 mg, 50 mg.
2-amino-4-(butylamino)-N-[(1S)-1-phenylethyl]quinazoline-5-carboxamide (CAS 2178156-33-5) is a chemical compound with the molecular formula C21H25N5O and a molecular weight of 363.5 g/mol. IUPAC name: 2-amino-4-(butylamino)-N-[(1S)-1-phenylethyl]quinazoline-5-carboxamide. InChIKey: WDFAZLUMAXOURM-AWEZNQCLSA-N.
| Molecular formula | C21H25N5O |
|---|---|
| Molecular weight | 363.5 g/mol |
| IUPAC name | 2-amino-4-(butylamino)-N-[(1S)-1-phenylethyl]quinazoline-5-carboxamide |
| InChIKey | WDFAZLUMAXOURM-AWEZNQCLSA-N |
| SMILES | CCCCNC1=NC(=NC2=CC=CC(=C21)C(=O)N[C@@H](C)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)