CAS 217816-60-9 appears in our catalog under these names: 3-Bromo-2-fluoro-6-iodobenzamide, 95%, 3-Bromo-2-fluoro-6-iodobenzamide, 97%, 3–bromo–2–fluoro–6–iodobenzamide. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
3-bromo-2-fluoro-6-iodobenzamide (CAS 217816-60-9) is a chemical compound with the molecular formula C7H4BrFINO and a molecular weight of 343.92 g/mol. IUPAC name: 3-bromo-2-fluoro-6-iodobenzamide. InChIKey: OCVCKYMZLWKZMC-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFINO |
|---|---|
| Molecular weight | 343.92 g/mol |
| IUPAC name | 3-bromo-2-fluoro-6-iodobenzamide |
| InChIKey | OCVCKYMZLWKZMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Br)F)C(=O)N)I |
Computed by PubChem (NCBI)