CAS 2179-15-9 appears in our catalog under these names: Z-Lys-onp hydrochloride, 95%, Z–Lys–ONp · HCl, N-α-Z-L-lysine 4-nitrophenyl ester hydrochloride, N-A-CBZ-L-LYSINE P-NITROPHENYL ESTER, N-A-CBZ-L-LYSINE P-NITROPHENYL ESTER &. Offered by: Combi-blocks, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 1g, 250mg, 2g, 10g, 100MG, 100 mg, 1 g.
(4-nitrophenyl) (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate;hydrochloride (CAS 2179-15-9) is a chemical compound with the molecular formula C20H24ClN3O6 and a molecular weight of 437.9 g/mol. IUPAC name: (4-nitrophenyl) (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate;hydrochloride. InChIKey: JFZLPXVXTZKFDV-FERBBOLQSA-N.
| Molecular formula | C20H24ClN3O6 |
|---|---|
| Molecular weight | 437.9 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate;hydrochloride |
| InChIKey | JFZLPXVXTZKFDV-FERBBOLQSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCCCN)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)