CAS 2179038-41-4 appears in our catalog under these names: 6-Bromo-1-chloro-2-(methoxymethoxy)naphthalene, 95%, 6-Bromo-1-chloro-2-(methoxymethoxy)naphthalene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
6-bromo-1-chloro-2-(methoxymethoxy)naphthalene (CAS 2179038-41-4) is a chemical compound with the molecular formula C12H10BrClO2 and a molecular weight of 301.56 g/mol. IUPAC name: 6-bromo-1-chloro-2-(methoxymethoxy)naphthalene. InChIKey: NZTHCMRCJAQZGB-UHFFFAOYSA-N.
| Molecular formula | C12H10BrClO2 |
|---|---|
| Molecular weight | 301.56 g/mol |
| IUPAC name | 6-bromo-1-chloro-2-(methoxymethoxy)naphthalene |
| InChIKey | NZTHCMRCJAQZGB-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C2=C(C=C1)C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)