CAS 2179038-47-0 appears in our catalog under these names: 6-Chloro-2-fluoro-3-(methoxymethoxy)benzoic acid, 95%, 6-Chloro-2-fluoro-3-(methoxymethoxy)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
6-chloro-2-fluoro-3-(methoxymethoxy)benzoic acid (CAS 2179038-47-0) is a chemical compound with the molecular formula C9H8ClFO4 and a molecular weight of 234.61 g/mol. IUPAC name: 6-chloro-2-fluoro-3-(methoxymethoxy)benzoic acid. InChIKey: XEKOJOBAVYFZRG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO4 |
|---|---|
| Molecular weight | 234.61 g/mol |
| IUPAC name | 6-chloro-2-fluoro-3-(methoxymethoxy)benzoic acid |
| InChIKey | XEKOJOBAVYFZRG-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C(=C(C=C1)Cl)C(=O)O)F |
Computed by PubChem (NCBI)