Products 2179038-52-7

CAS 2179038-52-7 is the registry number for 6-Bromo-2-fluoro-3-(methoxymethoxy)benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 6-bromo-2-fluoro-3-(methoxymethoxy)benzoate (CAS 2179038-52-7) is a chemical compound with the molecular formula C10H10BrFO4 and a molecular weight of 293.09 g/mol. IUPAC name: methyl 6-bromo-2-fluoro-3-(methoxymethoxy)benzoate. InChIKey: LWEWKTUOUOXFMV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10BrFO4
Molecular weight293.09 g/mol
IUPAC namemethyl 6-bromo-2-fluoro-3-(methoxymethoxy)benzoate
InChIKeyLWEWKTUOUOXFMV-UHFFFAOYSA-N
SMILESCOCOC1=C(C(=C(C=C1)Br)C(=O)OC)F

Computed by PubChem (NCBI)