CAS 217950-62-4 is the registry number for GW 275175X. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,4R,5R)-2-(2-bromo-5,6-dichlorobenzimidazol-1-yl)oxane-3,4,5-triol (CAS 217950-62-4) is a chemical compound with the molecular formula C12H11BrCl2N2O4 and a molecular weight of 398.03 g/mol. IUPAC name: (2R,3R,4R,5R)-2-(2-bromo-5,6-dichlorobenzimidazol-1-yl)oxane-3,4,5-triol. InChIKey: OOAVDXDURLPULP-GWOFURMSSA-N.
| Molecular formula | C12H11BrCl2N2O4 |
|---|---|
| Molecular weight | 398.03 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-(2-bromo-5,6-dichlorobenzimidazol-1-yl)oxane-3,4,5-triol |
| InChIKey | OOAVDXDURLPULP-GWOFURMSSA-N |
| SMILES | C1[C@H]([C@H]([C@H]([C@@H](O1)N2C3=CC(=C(C=C3N=C2Br)Cl)Cl)O)O)O |
Computed by PubChem (NCBI)