Products 217961-07-4

CAS 217961-07-4 is the registry number for tetraethyl heptane-1,1,7,7-tetracarboxylate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tetraethyl heptane-1,1,7,7-tetracarboxylate (CAS 217961-07-4) is a chemical compound with the molecular formula C19H32O8 and a molecular weight of 388.5 g/mol. IUPAC name: tetraethyl heptane-1,1,7,7-tetracarboxylate. InChIKey: GCINHJJAUKEYLS-UHFFFAOYSA-N.

Identity
Molecular formulaC19H32O8
Molecular weight388.5 g/mol
IUPAC nametetraethyl heptane-1,1,7,7-tetracarboxylate
InChIKeyGCINHJJAUKEYLS-UHFFFAOYSA-N
SMILESCCOC(=O)C(CCCCCC(C(=O)OCC)C(=O)OCC)C(=O)OCC

Computed by PubChem (NCBI)