Products 217975-51-4

CAS 217975-51-4 is the registry number for Gadobutrol Impurity 115. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4,10-bis(carboxymethyl)-7-formyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (CAS 217975-51-4) is a chemical compound with the molecular formula C15H26N4O7 and a molecular weight of 374.39 g/mol. IUPAC name: 2-[4,10-bis(carboxymethyl)-7-formyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid. InChIKey: PTZQGISORONQSJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26N4O7
Molecular weight374.39 g/mol
IUPAC name2-[4,10-bis(carboxymethyl)-7-formyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid
InChIKeyPTZQGISORONQSJ-UHFFFAOYSA-N
SMILESC1CN(CCN(CCN(CCN1CC(=O)O)CC(=O)O)C=O)CC(=O)O

Computed by PubChem (NCBI)