CAS 21808-55-9 is the registry number for Didesethyl Flurazepam Dihydrobromide. Offered by: TRC. Available pack sizes: 100mg.
Didesethylflurazepam is a primary amino compound resulting from the dealkylation of both ethyl groups of the anti-insomnia drug flurazepam. It is the major metabolite of flurazepam. It has a role as an anxiolytic drug, an anticonvulsant, a sedative, a drug metabolite and a GABAA receptor agonist. It is a 1,4-benzodiazepinone, an organochlorine compound, a primary amino compound and a member of monofluorobenzenes.
Source: ChEBI
| Molecular formula | C17H15ClFN3O |
|---|---|
| Molecular weight | 331.8 g/mol |
| IUPAC name | 1-(2-aminoethyl)-7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one |
| InChIKey | MVAUDJDXZPBWOW-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=C(C=C(C=C2)Cl)C(=N1)C3=CC=CC=C3F)CCN |
Computed by PubChem (NCBI)