Products 21810-39-9

CAS 21810-39-9 is the registry number for Acryloyloxyethyldiethylmethylammonium Methyl Sulfate. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

Diethyl-methyl-(2-prop-2-enoyloxyethyl)azanium;methyl sulfate (CAS 21810-39-9) is a chemical compound with the molecular formula C11H23NO6S and a molecular weight of 297.37 g/mol. IUPAC name: diethyl-methyl-(2-prop-2-enoyloxyethyl)azanium;methyl sulfate. InChIKey: BIWSOHCILAMHGH-UHFFFAOYSA-M.

Identity
Molecular formulaC11H23NO6S
Molecular weight297.37 g/mol
IUPAC namediethyl-methyl-(2-prop-2-enoyloxyethyl)azanium;methyl sulfate
InChIKeyBIWSOHCILAMHGH-UHFFFAOYSA-M
SMILESCC[N+](C)(CC)CCOC(=O)C=C.COS(=O)(=O)[O-]

Computed by PubChem (NCBI)