CAS 21810-39-9 is the registry number for Acryloyloxyethyldiethylmethylammonium Methyl Sulfate. Offered by: TRC. Available pack sizes: 250mg.
Diethyl-methyl-(2-prop-2-enoyloxyethyl)azanium;methyl sulfate (CAS 21810-39-9) is a chemical compound with the molecular formula C11H23NO6S and a molecular weight of 297.37 g/mol. IUPAC name: diethyl-methyl-(2-prop-2-enoyloxyethyl)azanium;methyl sulfate. InChIKey: BIWSOHCILAMHGH-UHFFFAOYSA-M.
| Molecular formula | C11H23NO6S |
|---|---|
| Molecular weight | 297.37 g/mol |
| IUPAC name | diethyl-methyl-(2-prop-2-enoyloxyethyl)azanium;methyl sulfate |
| InChIKey | BIWSOHCILAMHGH-UHFFFAOYSA-M |
| SMILES | CC[N+](C)(CC)CCOC(=O)C=C.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)