CAS 21816-08-0 appears in our catalog under these names: 3-Bromoadamantane-1-carboxylic acid, 95%, 3-Bromo-1-adamantane Carboxylic Acid, 3–Bromoadamantane–1–carboxylic acid, 3-Bromoadamantane-1-carboxylic acid, 97% , 3-Bromoadamantane-1-carboxylic acid. Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 100g, 50g, 500g.
3-bromoadamantane-1-carboxylic acid (CAS 21816-08-0) is a chemical compound with the molecular formula C11H15BrO2 and a molecular weight of 259.14 g/mol. IUPAC name: 3-bromoadamantane-1-carboxylic acid. InChIKey: DJUDQBVINJIMFO-UHFFFAOYSA-N.
| Molecular formula | C11H15BrO2 |
|---|---|
| Molecular weight | 259.14 g/mol |
| IUPAC name | 3-bromoadamantane-1-carboxylic acid |
| InChIKey | DJUDQBVINJIMFO-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)Br)C(=O)O |
Computed by PubChem (NCBI)