CAS 2181829-39-8 is the registry number for Methyl 2-bromo-5-fluoro-4-(4-methylphenylsulfonamido)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-bromo-5-fluoro-4-[(4-methylphenyl)sulfonylamino]benzoate (CAS 2181829-39-8) is a chemical compound with the molecular formula C15H13BrFNO4S and a molecular weight of 402.2 g/mol. IUPAC name: methyl 2-bromo-5-fluoro-4-[(4-methylphenyl)sulfonylamino]benzoate. InChIKey: UGIUQLMYOOKVBC-UHFFFAOYSA-N.
| Molecular formula | C15H13BrFNO4S |
|---|---|
| Molecular weight | 402.2 g/mol |
| IUPAC name | methyl 2-bromo-5-fluoro-4-[(4-methylphenyl)sulfonylamino]benzoate |
| InChIKey | UGIUQLMYOOKVBC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=C(C(=C2)Br)C(=O)OC)F |
Computed by PubChem (NCBI)