CAS 2182601-74-5 appears in our catalog under these names: Propargyl-peg8-nhs ester, 95%, Propargyl–PEG8–NHS ester, Propargyl-PEG8-NHS ester 95%, 4,7,10,13,16,19,22,25-Octaoxaoctacos-27-ynoic acid, 2,5-dioxo-1-pyrrolidinyl ester, 95%, 95%, Propargyl-PEG8-NHS ester, 97.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 500mg, 100mg, 1g, 250mg, 1 g, 100 mg, 250 mg, 5g.
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 2182601-74-5) is a chemical compound with the molecular formula C24H39NO12 and a molecular weight of 533.6 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: PFFLYBWAOVXONG-UHFFFAOYSA-N.
| Molecular formula | C24H39NO12 |
|---|---|
| Molecular weight | 533.6 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | PFFLYBWAOVXONG-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)