Products 218288-14-3
CAS 218288-14-3 is the registry number for N1-[4-Bromo-2-(trifluoromethyl)phenyl]-2-chloroacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-[4-bromo-2-(trifluoromethyl)phenyl]-2-chloroacetamide (CAS 218288-14-3) is a chemical compound with the molecular formula C9H6BrClF3NO and a molecular weight of 316.50 g/mol. IUPAC name: N-[4-bromo-2-(trifluoromethyl)phenyl]-2-chloroacetamide. InChIKey: TUXNWIBGQYIZRA-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClF3NO |
|---|---|
| Molecular weight | 316.50 g/mol |
| IUPAC name | N-[4-bromo-2-(trifluoromethyl)phenyl]-2-chloroacetamide |
| InChIKey | TUXNWIBGQYIZRA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(F)(F)F)NC(=O)CCl |
Computed by PubChem (NCBI)