Products 2183440-42-6
CAS 2183440-42-6 appears in our catalog under these names: FAM amine, 6-isomer, 98.12%, FAM amine, 6-isomer, 95%, FAM amine, 6-isomer, 95%, 95%, FAM amine, 6–isomer. Offered by: MedChemExpress, Ambeed, Chemat, GLPBio, Lumiprobe. Available pack sizes: 5 mg, 10 mg, 1 mg, 1mg, 5mg, 10mg, 25mg, 50mg.
N-(6-aminohexyl)-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide;hydrochloride (CAS 2183440-42-6) is a chemical compound with the molecular formula C27H27ClN2O6 and a molecular weight of 511.0 g/mol. IUPAC name: N-(6-aminohexyl)-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide;hydrochloride. InChIKey: BHBCBUGWIUDCSL-UHFFFAOYSA-N.
| Molecular formula | C27H27ClN2O6 |
|---|---|
| Molecular weight | 511.0 g/mol |
| IUPAC name | N-(6-aminohexyl)-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide;hydrochloride |
| InChIKey | BHBCBUGWIUDCSL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)NCCCCCCN)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O.Cl |
Computed by PubChem (NCBI)