CAS 2183440-64-2 appears in our catalog under these names: FAM hydrazide, 5-isomer, 95%, FAM hydrazide, 5–isomer, FAM hydrazide,5-isomer. Offered by: Lumiprobe, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg, Get quote.
[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]azanium (CAS 2183440-64-2) is a chemical compound with the molecular formula C21H15N2O6+ and a molecular weight of 391.4 g/mol. IUPAC name: [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]azanium. InChIKey: ZJLTXRWYPNRWBS-UHFFFAOYSA-O.
| Molecular formula | C21H15N2O6+ |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]azanium |
| InChIKey | ZJLTXRWYPNRWBS-UHFFFAOYSA-O |
| SMILES | C1=CC2=C(C=C1C(=O)N[NH3+])C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Computed by PubChem (NCBI)