CAS 2183900-02-7 is the registry number for N-(2,3-Dimethoxyphenyl)-2,2-dimethylpropanamide. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
N-(2,3-dimethoxyphenyl)-2,2-dimethylpropanamide (CAS 2183900-02-7) is a chemical compound with the molecular formula C13H19NO3 and a molecular weight of 237.29 g/mol. IUPAC name: N-(2,3-dimethoxyphenyl)-2,2-dimethylpropanamide. InChIKey: OGOIFKUEFZONBN-UHFFFAOYSA-N.
| Molecular formula | C13H19NO3 |
|---|---|
| Molecular weight | 237.29 g/mol |
| IUPAC name | N-(2,3-dimethoxyphenyl)-2,2-dimethylpropanamide |
| InChIKey | OGOIFKUEFZONBN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C(=CC=C1)OC)OC |
Computed by PubChem (NCBI)