CAS 21840-08-4 is the registry number for Melarsen Oxide. Offered by: TRC. Available pack sizes: 500mg, 50mg.
2-N-(4-arsorosophenyl)-1,3,5-triazine-2,4,6-triamine (CAS 21840-08-4) is a chemical compound with the molecular formula C9H9AsN6O and a molecular weight of 292.13 g/mol. IUPAC name: 2-N-(4-arsorosophenyl)-1,3,5-triazine-2,4,6-triamine. InChIKey: YDKGKLBKFOIXPU-UHFFFAOYSA-N.
| Molecular formula | C9H9AsN6O |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | 2-N-(4-arsorosophenyl)-1,3,5-triazine-2,4,6-triamine |
| InChIKey | YDKGKLBKFOIXPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC(=NC(=N2)N)N)[As]=O |
Computed by PubChem (NCBI)