CAS 218462-70-5 appears in our catalog under these names: N-(Potassiooxy)benzamide, n-hydroxybenzamide, 95%, (N-(Hydroxy-κO)benzamidato-κO)(N-hydroxybenzamide-κO)potassium, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
Potassium;N-hydroxybenzamide;N-oxidobenzamide (CAS 218462-70-5) is a chemical compound with the molecular formula C14H13KN2O4 and a molecular weight of 312.36 g/mol. IUPAC name: potassium;N-hydroxybenzamide;N-oxidobenzamide. InChIKey: AOBRUMWJSGMZID-UHFFFAOYSA-N.
| Molecular formula | C14H13KN2O4 |
|---|---|
| Molecular weight | 312.36 g/mol |
| IUPAC name | potassium;N-hydroxybenzamide;N-oxidobenzamide |
| InChIKey | AOBRUMWJSGMZID-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NO.C1=CC=C(C=C1)C(=O)N[O-].[K+] |
Computed by PubChem (NCBI)