Products 21849-40-1
CAS 21849-40-1 is the registry number for N,N-Dibromo-4-methylbenzenesulfonamide, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
N,N-dibromo-4-methylbenzenesulfonamide (CAS 21849-40-1) is a chemical compound with the molecular formula C7H7Br2NO2S and a molecular weight of 329.01 g/mol. IUPAC name: N,N-dibromo-4-methylbenzenesulfonamide. InChIKey: BEJBLYLRWIFFBD-UHFFFAOYSA-N.
| Molecular formula | C7H7Br2NO2S |
|---|---|
| Molecular weight | 329.01 g/mol |
| IUPAC name | N,N-dibromo-4-methylbenzenesulfonamide |
| InChIKey | BEJBLYLRWIFFBD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(Br)Br |
Computed by PubChem (NCBI)